C22H33FO5 — CID 54559308
methyl 5-[3-fluoro-5-hydroxy-4-[3-hydroxy-3-(1-methylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 54559308) has the molecular formula C22H33FO5 and a molecular weight of 396.50 g/mol. Its IUPAC name is methyl 5-[3-fluoro-5-hydroxy-4-[3-hydroxy-3-(1-methylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | methyl 5-[3-fluoro-5-hydroxy-4-[3-hydroxy-3-(1-methylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 54559308 |
| Molecular Formula | C22H33FO5 |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.23 |
| IUPAC Name | methyl 5-[3-fluoro-5-hydroxy-4-[3-hydroxy-3-(1-methylcyclopentyl)prop-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | COC(=O)CCCC=C1OC2CC(O)C(C=CC(O)C3(C)CCCC3)C2C1F |
| InChI | InChI=1S/C22H33FO5/c1-22(11-5-6-12-22)18(25)10-9-14-15(24)13-17-20(14)21(23)16(28-17)7-3-4-8-19(26)27-2/h7,9-10,14-15,17-18,20-21,24-25H,3-6,8,11-13H2,1-2H3 |
| InChIKey | ZPKJZUBYQSMVOI-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|