C21H33ClO5 — CID 70595811
methyl (5Z)-5-[(3aR,4R,5R,6aR)-4-[(E,3S)-8-chloro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 70595811) has the molecular formula C21H33ClO5 and a molecular weight of 400.94 g/mol. Its IUPAC name is methyl (5Z)-5-[(3aR,4R,5R,6aR)-4-[(E,3S)-8-chloro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | methyl (5Z)-5-[(3aR,4R,5R,6aR)-4-[(E,3S)-8-chloro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 70595811 |
| Molecular Formula | C21H33ClO5 |
| Molecular Weight | 400.94 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | methyl (5Z)-5-[(3aR,4R,5R,6aR)-4-[(E,3S)-8-chloro-3-hydroxyoct-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | COC(=O)CCC/C=C1/C[C@@H]2[C@@H](/C=C/[C@@H](O)CCCCCCl)[C@H](O)C[C@H]2O1 |
| InChI | InChI=1S/C21H33ClO5/c1-26-21(25)9-5-4-8-16-13-18-17(19(24)14-20(18)27-16)11-10-15(23)7-3-2-6-12-22/h8,10-11,15,17-20,23-24H,2-7,9,12-14H2,1H3/b11-10+,16-8-/t15-,17+,18+,19+,20+/m0/s1 |
| InChIKey | SEEMTUOZWCZEQH-YKAPSHOQSA-N |
| XLogP | 3.72 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.94 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|