C24H38O7 — CID 70592959
(2-ethoxy-2-oxoethyl) (5Z)-5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate (PubChem CID 70592959) has the molecular formula C24H38O7 and a molecular weight of 438.56 g/mol. Its IUPAC name is (2-ethoxy-2-oxoethyl) (5Z)-5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate.
| Compound Name | (2-ethoxy-2-oxoethyl) (5Z)-5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 70592959 |
| Molecular Formula | C24H38O7 |
| Molecular Weight | 438.56 g/mol |
| Exact Mass | 438.26 |
| IUPAC Name | (2-ethoxy-2-oxoethyl) (5Z)-5-[(3aR,4R,5R,6aR)-5-hydroxy-4-[(E,3S)-3-hydroxyoct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoate |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2C/C(=C/CCCC(=O)OCC(=O)OCC)O[C@@H]2C[C@H]1O |
| InChI | InChI=1S/C24H38O7/c1-3-5-6-9-17(25)12-13-19-20-14-18(31-22(20)15-21(19)26)10-7-8-11-23(27)30-16-24(28)29-4-2/h10,12-13,17,19-22,25-26H,3-9,11,14-16H2,1-2H3/b13-12+,18-10-/t17-,19+,20+,21+,22+/m0/s1 |
| InChIKey | QHOXPEPGWLEGCB-MQKMRASMSA-N |
| XLogP | 3.43 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|