C22H34O7 — CID 123903917
5-[5-hydroxy-4-(3-methoxycarbonyloxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid (PubChem CID 123903917) has the molecular formula C22H34O7 and a molecular weight of 410.51 g/mol. Its IUPAC name is 5-[5-hydroxy-4-(3-methoxycarbonyloxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid.
| Compound Name | 5-[5-hydroxy-4-(3-methoxycarbonyloxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 123903917 |
| Molecular Formula | C22H34O7 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 5-[5-hydroxy-4-(3-methoxycarbonyloxyoct-1-enyl)-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-ylidene]pentanoic acid |
| SMILES | CCCCCC(C=CC1C(O)CC2OC(=CCCCC(=O)O)CC21)OC(=O)OC |
| InChI | InChI=1S/C22H34O7/c1-3-4-5-8-15(29-22(26)27-2)11-12-17-18-13-16(9-6-7-10-21(24)25)28-20(18)14-19(17)23/h9,11-12,15,17-20,23H,3-8,10,13-14H2,1-2H3,(H,24,25) |
| InChIKey | ZDSXGJJMCLEJOH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|