C26H42O4 — CID 54097477
methyl 5-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,5R)-3-hydroxy-5,9-dimethyldeca-1,8-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 54097477) has the molecular formula C26H42O4 and a molecular weight of 418.62 g/mol. Its IUPAC name is methyl 5-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,5R)-3-hydroxy-5,9-dimethyldeca-1,8-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | methyl 5-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,5R)-3-hydroxy-5,9-dimethyldeca-1,8-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 54097477 |
| Molecular Formula | C26H42O4 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.31 |
| IUPAC Name | methyl 5-[(3aS,4S,5R,6aS)-5-hydroxy-4-[(3S,5R)-3-hydroxy-5,9-dimethyldeca-1,8-dienyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | COC(=O)CCCC=C1C[C@H]2C[C@@H](O)[C@@H](C=C[C@@H](O)C[C@H](C)CCC=C(C)C)[C@H]2C1 |
| InChI | InChI=1S/C26H42O4/c1-18(2)8-7-9-19(3)14-22(27)12-13-23-24-16-20(15-21(24)17-25(23)28)10-5-6-11-26(29)30-4/h8,10,12-13,19,21-25,27-28H,5-7,9,11,14-17H2,1-4H3/t19-,21+,22-,23+,24+,25-/m1/s1 |
| InChIKey | MYDHBPPXXWNFPP-MSIQWTOJSA-N |
| XLogP | 5.35 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|