C25H40O4 — CID 22828412
(5E)-5-[(3aS,4R,5R,6aR)-4-[(E,3R)-5-cyclohexyl-3-hydroxyhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid (PubChem CID 22828412) has the molecular formula C25H40O4 and a molecular weight of 404.59 g/mol. Its IUPAC name is (5E)-5-[(3aS,4R,5R,6aR)-4-[(E,3R)-5-cyclohexyl-3-hydroxyhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid.
| Compound Name | (5E)-5-[(3aS,4R,5R,6aR)-4-[(E,3R)-5-cyclohexyl-3-hydroxyhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
|---|---|
| PubChem CID | 22828412 |
| Molecular Formula | C25H40O4 |
| Molecular Weight | 404.59 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (5E)-5-[(3aS,4R,5R,6aR)-4-[(E,3R)-5-cyclohexyl-3-hydroxyhex-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoic acid |
| SMILES | CC(C[C@@H](O)/C=C/[C@@H]1[C@H]2C/C(=C/CCCC(=O)O)C[C@@H]2C[C@H]1O)C1CCCCC1 |
| InChI | InChI=1S/C25H40O4/c1-17(19-8-3-2-4-9-19)13-21(26)11-12-22-23-15-18(7-5-6-10-25(28)29)14-20(23)16-24(22)27/h7,11-12,17,19-24,26-27H,2-6,8-10,13-16H2,1H3,(H,28,29)/b12-11+,18-7+/t17?,20-,21+,22-,23+,24-/m1/s1 |
| InChIKey | MLPOFBLWIJSVTI-WRJDKFSXSA-N |
| XLogP | 5.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|