C25H41NO3 — CID 90932677
5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-butylpentanamide (PubChem CID 90932677) has the molecular formula C25H41NO3 and a molecular weight of 403.61 g/mol. Its IUPAC name is 5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-butylpentanamide.
| Compound Name | 5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-butylpentanamide |
|---|---|
| PubChem CID | 90932677 |
| Molecular Formula | C25H41NO3 |
| Molecular Weight | 403.61 g/mol |
| Exact Mass | 403.31 |
| IUPAC Name | 5-[(3aS,4R,5R,6aS)-4-[(3S)-3-cyclopentyl-3-hydroxyprop-1-enyl]-5-hydroxy-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-butylpentanamide |
| SMILES | CCCCNC(=O)CCCC=C1C[C@H]2C[C@@H](O)[C@H](C=C[C@@H](O)C3CCCC3)[C@H]2C1 |
| InChI | InChI=1S/C25H41NO3/c1-2-3-14-26-25(29)11-7-4-8-18-15-20-17-24(28)21(22(20)16-18)12-13-23(27)19-9-5-6-10-19/h8,12-13,19-24,27-28H,2-7,9-11,14-17H2,1H3,(H,26,29)/t20-,21+,22-,23+,24+/m0/s1 |
| InChIKey | LOMOBIXTACDNHX-OEYYQIPYSA-N |
| XLogP | 4.51 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.61 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|