C29H39NO3 — CID 91125764
5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide (PubChem CID 91125764) has the molecular formula C29H39NO3 and a molecular weight of 449.64 g/mol. Its IUPAC name is 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide.
| Compound Name | 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide |
|---|---|
| PubChem CID | 91125764 |
| Molecular Formula | C29H39NO3 |
| Molecular Weight | 449.64 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 5-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(3S,4S)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]-N-benzylpentanamide |
| SMILES | CC#CC[C@H](C)[C@H](O)C=C[C@@H]1[C@H]2CC(=CCCCC(=O)NCc3ccccc3)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C29H39NO3/c1-3-4-10-21(2)27(31)16-15-25-26-18-23(17-24(26)19-28(25)32)13-8-9-14-29(33)30-20-22-11-6-5-7-12-22/h5-7,11-13,15-16,21,24-28,31-32H,8-10,14,17-20H2,1-2H3,(H,30,33)/t21-,24-,25+,26-,27+,28+/m0/s1 |
| InChIKey | RZGOEGZYHVIAPG-QUOYWZEHSA-N |
| XLogP | 4.77 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.64 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|