C23H37O4P — CID 11475322
[(4E)-4-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butyl]-ethylphosphinic acid (PubChem CID 11475322) has the molecular formula C23H37O4P and a molecular weight of 408.52 g/mol. Its IUPAC name is [(4E)-4-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butyl]-ethylphosphinic acid.
| Compound Name | [(4E)-4-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butyl]-ethylphosphinic acid |
|---|---|
| PubChem CID | 11475322 |
| Molecular Formula | C23H37O4P |
| Molecular Weight | 408.52 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | [(4E)-4-[(3aS,4R,5R,6aS)-5-hydroxy-4-[(E)-3-hydroxy-4-methyloct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butyl]-ethylphosphinic acid |
| SMILES | CC#CCC(C)C(O)/C=C/[C@@H]1[C@H]2C/C(=C/CCCP(=O)(O)CC)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C23H37O4P/c1-4-6-9-17(3)22(24)12-11-20-21-15-18(14-19(21)16-23(20)25)10-7-8-13-28(26,27)5-2/h10-12,17,19-25H,5,7-9,13-16H2,1-3H3,(H,26,27)/b12-11+,18-10+/t17?,19-,20+,21-,22?,23+/m0/s1 |
| InChIKey | IEJZWGXRWMBXPQ-MYFLSYPZSA-N |
| XLogP | 4.36 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.52 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|