C26H43NO3 — CID 91116754
(1R,2R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethylidene]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol (PubChem CID 91116754) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is (1R,2R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethylidene]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol.
| Compound Name | (1R,2R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethylidene]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
|---|---|
| PubChem CID | 91116754 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | (1R,2R,3aS,6aS)-5-[2-[2-[tert-butyl(methyl)amino]ethoxy]ethylidene]-1-[(3S,4R)-3-hydroxy-4-methyloct-1-en-6-ynyl]-2,3,3a,4,6,6a-hexahydro-1H-pentalen-2-ol |
| SMILES | CC#CC[C@@H](C)[C@H](O)C=C[C@@H]1[C@H]2CC(=CCOCCN(C)C(C)(C)C)C[C@H]2C[C@H]1O |
| InChI | InChI=1S/C26H43NO3/c1-7-8-9-19(2)24(28)11-10-22-23-17-20(16-21(23)18-25(22)29)12-14-30-15-13-27(6)26(3,4)5/h10-12,19,21-25,28-29H,9,13-18H2,1-6H3/t19-,21+,22-,23+,24-,25-/m1/s1 |
| InChIKey | PPHMZIHGZHWKIW-JPGXGPOUSA-N |
| XLogP | 4.03 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|