C22H30O4 — CID 170376075
methyl (4Z)-4-[(3aS,4R,5R)-5-hydroxy-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butanoate (PubChem CID 170376075) has the molecular formula C22H30O4 and a molecular weight of 358.48 g/mol. Its IUPAC name is methyl (4Z)-4-[(3aS,4R,5R)-5-hydroxy-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butanoate.
| Compound Name | methyl (4Z)-4-[(3aS,4R,5R)-5-hydroxy-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butanoate |
|---|---|
| PubChem CID | 170376075 |
| Molecular Formula | C22H30O4 |
| Molecular Weight | 358.48 g/mol |
| Exact Mass | 358.21 |
| IUPAC Name | methyl (4Z)-4-[(3aS,4R,5R)-5-hydroxy-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]butanoate |
| SMILES | CC#CCC(C)C(=O)/C=C/[C@H]1[C@H](O)CC2C/C(=C/CCC(=O)OC)C[C@@H]21 |
| InChI | InChI=1S/C22H30O4/c1-4-5-7-15(2)20(23)11-10-18-19-13-16(8-6-9-22(25)26-3)12-17(19)14-21(18)24/h8,10-11,15,17-19,21,24H,6-7,9,12-14H2,1-3H3/b11-10+,16-8-/t15?,17?,18-,19+,21-/m1/s1 |
| InChIKey | ZTYGDKRXIDSXKV-ZVPIHUIRSA-N |
| XLogP | 3.45 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.48 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|