C28H40O5 — CID 146208551
methyl (5E)-5-[(4R,5S)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate (PubChem CID 146208551) has the molecular formula C28H40O5 and a molecular weight of 456.62 g/mol. Its IUPAC name is methyl (5E)-5-[(4R,5S)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate.
| Compound Name | methyl (5E)-5-[(4R,5S)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
|---|---|
| PubChem CID | 146208551 |
| Molecular Formula | C28H40O5 |
| Molecular Weight | 456.62 g/mol |
| Exact Mass | 456.29 |
| IUPAC Name | methyl (5E)-5-[(4R,5S)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanoate |
| SMILES | CC#CCC(C)C(=O)/C=C/[C@@H]1C2C/C(=C/CCCC(=O)OC)CC2C[C@@H]1OC1CCCCO1 |
| InChI | InChI=1S/C28H40O5/c1-4-5-10-20(2)25(29)15-14-23-24-18-21(11-6-7-12-27(30)31-3)17-22(24)19-26(23)33-28-13-8-9-16-32-28/h11,14-15,20,22-24,26,28H,6-10,12-13,16-19H2,1-3H3/b15-14+,21-11+/t20?,22?,23-,24?,26+,28?/m1/s1 |
| InChIKey | MGNVJMAQFQBBTK-NNLCEOOOSA-N |
| XLogP | 5.39 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.62 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|