C29H42O5 — CID 67928158
(2E)-2-[(3aS,4S,5R,6aS)-4-[(3S)-4-methyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol (PubChem CID 67928158) has the molecular formula C29H42O5 and a molecular weight of 470.65 g/mol. Its IUPAC name is (2E)-2-[(3aS,4S,5R,6aS)-4-[(3S)-4-methyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol.
| Compound Name | (2E)-2-[(3aS,4S,5R,6aS)-4-[(3S)-4-methyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
|---|---|
| PubChem CID | 67928158 |
| Molecular Formula | C29H42O5 |
| Molecular Weight | 470.65 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | (2E)-2-[(3aS,4S,5R,6aS)-4-[(3S)-4-methyl-3-(oxan-2-yloxy)octa-1,6-diynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethanol |
| SMILES | CC#CCC(C)[C@@H](C#C[C@@H]1[C@H]2C/C(=C/CO)C[C@H]2C[C@H]1OC1CCCCO1)OC1CCCCO1 |
| InChI | InChI=1S/C29H42O5/c1-3-4-9-21(2)26(33-28-10-5-7-16-31-28)13-12-24-25-19-22(14-15-30)18-23(25)20-27(24)34-29-11-6-8-17-32-29/h14,21,23-30H,5-11,15-20H2,1-2H3/b22-14+/t21?,23-,24+,25-,26+,27+,28?,29?/m0/s1 |
| InChIKey | KUDUZGYHIJBVHA-QQOSYWRMSA-N |
| XLogP | 4.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.65 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|