C28H42O5 — CID 153353528
(5E)-5-[(3aS,5R,6aS)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanal;methanol (PubChem CID 153353528) has the molecular formula C28H42O5 and a molecular weight of 458.64 g/mol. Its IUPAC name is (5E)-5-[(3aS,5R,6aS)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanal;methanol.
| Compound Name | (5E)-5-[(3aS,5R,6aS)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanal;methanol |
|---|---|
| PubChem CID | 153353528 |
| Molecular Formula | C28H42O5 |
| Molecular Weight | 458.64 g/mol |
| Exact Mass | 458.30 |
| IUPAC Name | (5E)-5-[(3aS,5R,6aS)-4-[(E)-4-methyl-3-oxooct-1-en-6-ynyl]-5-(oxan-2-yloxy)-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]pentanal;methanol |
| SMILES | CC#CCC(C)C(=O)/C=C/C1[C@H]2C/C(=C/CCCC=O)C[C@H]2C[C@H]1OC1CCCCO1.CO |
| InChI | InChI=1S/C27H38O4.CH4O/c1-3-4-10-20(2)25(29)14-13-23-24-18-21(11-6-5-8-15-28)17-22(24)19-26(23)31-27-12-7-9-16-30-27;1-2/h11,13-15,20,22-24,26-27H,5-10,12,16-19H2,1-2H3;2H,1H3/b14-13+,21-11+;/t20?,22-,23?,24-,26+,27?;/m0./s1 |
| InChIKey | RWUWUCVXONWWGB-ODWTXQMRSA-N |
| XLogP | 5.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.64 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|