C29H46O6 — CID 11092178
tert-butyl 2-[(2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate (PubChem CID 11092178) has the molecular formula C29H46O6 and a molecular weight of 490.68 g/mol. Its IUPAC name is tert-butyl 2-[(2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate.
| Compound Name | tert-butyl 2-[(2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate |
|---|---|
| PubChem CID | 11092178 |
| Molecular Formula | C29H46O6 |
| Molecular Weight | 490.68 g/mol |
| Exact Mass | 490.33 |
| IUPAC Name | tert-butyl 2-[(2E)-2-[(3aS,4R,5R,6aS)-5-(oxan-2-yloxy)-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydro-1H-pentalen-2-ylidene]ethoxy]acetate |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@H]2C/C(=C/COCC(=O)OC(C)(C)C)C[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C29H46O6/c1-5-6-7-10-23(30)12-13-24-25-18-21(14-16-32-20-27(31)35-29(2,3)4)17-22(25)19-26(24)34-28-11-8-9-15-33-28/h12-14,22,24-26,28H,5-11,15-20H2,1-4H3/b13-12+,21-14+/t22-,24+,25-,26+,28?/m0/s1 |
| InChIKey | MQEJFKJWLAHXPD-KQOAZBGCSA-N |
| XLogP | 5.93 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.68 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|