C25H38O5 — CID 167430103
(6Z,8aR,9R,10R,11aS)-10-(oxan-2-yloxy)-9-[(E)-3-oxooct-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one (PubChem CID 167430103) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is (6Z,8aR,9R,10R,11aS)-10-(oxan-2-yloxy)-9-[(E)-3-oxooct-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one.
| Compound Name | (6Z,8aR,9R,10R,11aS)-10-(oxan-2-yloxy)-9-[(E)-3-oxooct-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
|---|---|
| PubChem CID | 167430103 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | (6Z,8aR,9R,10R,11aS)-10-(oxan-2-yloxy)-9-[(E)-3-oxooct-1-enyl]-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
| SMILES | CCCCCC(=O)/C=C/[C@@H]1[C@H]2C/C=C\CCCC(=O)O[C@H]2C[C@H]1OC1CCCCO1 |
| InChI | InChI=1S/C25H38O5/c1-2-3-6-11-19(26)15-16-21-20-12-7-4-5-8-13-24(27)29-22(20)18-23(21)30-25-14-9-10-17-28-25/h4,7,15-16,20-23,25H,2-3,5-6,8-14,17-18H2,1H3/b7-4-,16-15+/t20-,21-,22+,23-,25?/m1/s1 |
| InChIKey | LJDMLOOJNOQECA-BTXBHJGDSA-N |
| XLogP | 5.28 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|