C17H24O5 — CID 20621474
[2-oxo-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 20621474) has the molecular formula C17H24O5 and a molecular weight of 308.37 g/mol. Its IUPAC name is [2-oxo-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [2-oxo-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 20621474 |
| Molecular Formula | C17H24O5 |
| Molecular Weight | 308.37 g/mol |
| Exact Mass | 308.16 |
| IUPAC Name | [2-oxo-4-[(E)-3-oxooct-1-enyl]-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CCCCCC(=O)/C=C/C1C(OC(C)=O)CC2OC(=O)CC21 |
| InChI | InChI=1S/C17H24O5/c1-3-4-5-6-12(19)7-8-13-14-9-17(20)22-16(14)10-15(13)21-11(2)18/h7-8,13-16H,3-6,9-10H2,1-2H3/b8-7+ |
| InChIKey | AOVAJNRSFOBRTB-BQYQJAHWSA-N |
| XLogP | 2.58 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|