C10H12O5 — CID 88877974
[(4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate (PubChem CID 88877974) has the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. Its IUPAC name is [(4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate.
| Compound Name | [(4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
|---|---|
| PubChem CID | 88877974 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | [(4R,5R,6aS)-4-formyl-2-oxo-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C[C@@H]2OC(=O)CC2[C@H]1C=O |
| InChI | InChI=1S/C10H12O5/c1-5(12)14-9-3-8-6(7(9)4-11)2-10(13)15-8/h4,6-9H,2-3H2,1H3/t6?,7-,8+,9-/m1/s1 |
| InChIKey | AGDLDHIMDSXAKF-XWKBEBHTSA-N |
| XLogP | 0.07 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|