C25H42O4 — CID 122493470
(6Z,9R,10R)-9-(3-oxodecyl)-10-propan-2-yloxy-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one (PubChem CID 122493470) has the molecular formula C25H42O4 and a molecular weight of 406.61 g/mol. Its IUPAC name is (6Z,9R,10R)-9-(3-oxodecyl)-10-propan-2-yloxy-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one.
| Compound Name | (6Z,9R,10R)-9-(3-oxodecyl)-10-propan-2-yloxy-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
|---|---|
| PubChem CID | 122493470 |
| Molecular Formula | C25H42O4 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.31 |
| IUPAC Name | (6Z,9R,10R)-9-(3-oxodecyl)-10-propan-2-yloxy-4,5,8,8a,9,10,11,11a-octahydro-3H-cyclopenta[b]oxecin-2-one |
| SMILES | CCCCCCCC(=O)CC[C@@H]1C2C/C=C\CCCC(=O)OC2C[C@H]1OC(C)C |
| InChI | InChI=1S/C25H42O4/c1-4-5-6-7-10-13-20(26)16-17-22-21-14-11-8-9-12-15-25(27)29-24(21)18-23(22)28-19(2)3/h8,11,19,21-24H,4-7,9-10,12-18H2,1-3H3/b11-8-/t21?,22-,23-,24?/m1/s1 |
| InChIKey | YYOMDDMATWQZHL-SIPLUIEGSA-N |
| XLogP | 6.17 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|