C39H68O6 — CID 118012572
[(14Z)-6,23-dioxo-1,5-dioxacyclotricos-14-en-3-yl] (E)-octadec-9-enoate (PubChem CID 118012572) has the molecular formula C39H68O6 and a molecular weight of 632.97 g/mol. Its IUPAC name is [(14Z)-6,23-dioxo-1,5-dioxacyclotricos-14-en-3-yl] (E)-octadec-9-enoate.
| Compound Name | [(14Z)-6,23-dioxo-1,5-dioxacyclotricos-14-en-3-yl] (E)-octadec-9-enoate |
|---|---|
| PubChem CID | 118012572 |
| Molecular Formula | C39H68O6 |
| Molecular Weight | 632.97 g/mol |
| Exact Mass | 632.50 |
| IUPAC Name | [(14Z)-6,23-dioxo-1,5-dioxacyclotricos-14-en-3-yl] (E)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C/CCCCCCCC(=O)OC1COC(=O)CCCCCCC/C=C\CCCCCCCC(=O)OC1 |
| InChI | InChI=1S/C39H68O6/c1-2-3-4-5-6-7-8-9-10-15-18-21-24-27-30-33-39(42)45-36-34-43-37(40)31-28-25-22-19-16-13-11-12-14-17-20-23-26-29-32-38(41)44-35-36/h9-12,36H,2-8,13-35H2,1H3/b10-9+,12-11- |
| InChIKey | XCXIWVTVDWIPHQ-PVHUKWJHSA-N |
| XLogP | 11.05 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.97 |
| LogP ≤ 5 | 11.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|