C21H38O2 — CID 45029054
(6Z)-2-dodecyl-2,3,4,5,8,9-hexahydrooxecin-10-one (PubChem CID 45029054) has the molecular formula C21H38O2 and a molecular weight of 322.53 g/mol. Its IUPAC name is (6Z)-2-dodecyl-2,3,4,5,8,9-hexahydrooxecin-10-one.
| Compound Name | (6Z)-2-dodecyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 45029054 |
| Molecular Formula | C21H38O2 |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.29 |
| IUPAC Name | (6Z)-2-dodecyl-2,3,4,5,8,9-hexahydrooxecin-10-one |
| SMILES | CCCCCCCCCCCCC1CCC/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C21H38O2/c1-2-3-4-5-6-7-8-9-11-14-17-20-18-15-12-10-13-16-19-21(22)23-20/h10,13,20H,2-9,11-12,14-19H2,1H3/b13-10- |
| InChIKey | OTRPEJFCBJDQMD-RAXLEYEMSA-N |
| XLogP | 6.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|