C11H18O2 — CID 101251171
(4Z)-2-butyl-2,3,6,7-tetrahydrooxocin-8-one (PubChem CID 101251171) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is (4Z)-2-butyl-2,3,6,7-tetrahydrooxocin-8-one.
| Compound Name | (4Z)-2-butyl-2,3,6,7-tetrahydrooxocin-8-one |
|---|---|
| PubChem CID | 101251171 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | (4Z)-2-butyl-2,3,6,7-tetrahydrooxocin-8-one |
| SMILES | CCCCC1C/C=C\CCC(=O)O1 |
| InChI | InChI=1S/C11H18O2/c1-2-3-7-10-8-5-4-6-9-11(12)13-10/h4-5,10H,2-3,6-9H2,1H3/b5-4- |
| InChIKey | KOCCEMDIEZLAIW-PLNGDYQASA-N |
| XLogP | 2.83 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|