C20H32O4 — CID 91936907
(2S)-2-pentyl-2,3-dihydropyran-6-one;(2R)-2-pentyl-2,3-dihydropyran-6-one (PubChem CID 91936907) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is (2S)-2-pentyl-2,3-dihydropyran-6-one;(2R)-2-pentyl-2,3-dihydropyran-6-one.
| Compound Name | (2S)-2-pentyl-2,3-dihydropyran-6-one;(2R)-2-pentyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 91936907 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | (2S)-2-pentyl-2,3-dihydropyran-6-one;(2R)-2-pentyl-2,3-dihydropyran-6-one |
| SMILES | CCCCC[C@@H]1CC=CC(=O)O1.CCCCC[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/2C10H16O2/c2*1-2-3-4-6-9-7-5-8-10(11)12-9/h2*5,8-9H,2-4,6-7H2,1H3/t2*9-/m10/s1 |
| InChIKey | AAPBWRMANRUSHL-IGXPJQGBSA-N |
| XLogP | 4.88 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|