C16H28O2 — CID 91350217
2-decyl-3,6-dihydro-2H-oxepin-7-one (PubChem CID 91350217) has the molecular formula C16H28O2 and a molecular weight of 252.40 g/mol. Its IUPAC name is 2-decyl-3,6-dihydro-2H-oxepin-7-one.
| Compound Name | 2-decyl-3,6-dihydro-2H-oxepin-7-one |
|---|---|
| PubChem CID | 91350217 |
| Molecular Formula | C16H28O2 |
| Molecular Weight | 252.40 g/mol |
| Exact Mass | 252.21 |
| IUPAC Name | 2-decyl-3,6-dihydro-2H-oxepin-7-one |
| SMILES | CCCCCCCCCCC1CC=CCC(=O)O1 |
| InChI | InChI=1S/C16H28O2/c1-2-3-4-5-6-7-8-9-12-15-13-10-11-14-16(17)18-15/h10-11,15H,2-9,12-14H2,1H3 |
| InChIKey | HCPDLZWPOBMUOP-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.40 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|