C14H24O2 — CID 15825660
2-nonyl-2,3-dihydropyran-6-one (PubChem CID 15825660) has the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. Its IUPAC name is 2-nonyl-2,3-dihydropyran-6-one.
| Compound Name | 2-nonyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 15825660 |
| Molecular Formula | C14H24O2 |
| Molecular Weight | 224.34 g/mol |
| Exact Mass | 224.18 |
| IUPAC Name | 2-nonyl-2,3-dihydropyran-6-one |
| SMILES | CCCCCCCCCC1CC=CC(=O)O1 |
| InChI | InChI=1S/C14H24O2/c1-2-3-4-5-6-7-8-10-13-11-9-12-14(15)16-13/h9,12-13H,2-8,10-11H2,1H3 |
| InChIKey | CRCMEDPBLYDLQH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.34 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|