C15H28O — CID 11009621
(2S,7R)-2-hexyl-7-propyl-2,3,6,7-tetrahydrooxepine (PubChem CID 11009621) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is (2S,7R)-2-hexyl-7-propyl-2,3,6,7-tetrahydrooxepine.
| Compound Name | (2S,7R)-2-hexyl-7-propyl-2,3,6,7-tetrahydrooxepine |
|---|---|
| PubChem CID | 11009621 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | (2S,7R)-2-hexyl-7-propyl-2,3,6,7-tetrahydrooxepine |
| SMILES | CCCCCC[C@H]1CC=CC[C@@H](CCC)O1 |
| InChI | InChI=1S/C15H28O/c1-3-5-6-7-11-15-13-9-8-12-14(16-15)10-4-2/h8-9,14-15H,3-7,10-13H2,1-2H3/t14-,15+/m1/s1 |
| InChIKey | USICRFQPQJRPSW-CABCVRRESA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|