C13H24O2 — CID 142068689
(2S)-2-(3,3-dimethylbutyl)-2,3-dihydropyran-6-one;ethane (PubChem CID 142068689) has the molecular formula C13H24O2 and a molecular weight of 212.33 g/mol. Its IUPAC name is (2S)-2-(3,3-dimethylbutyl)-2,3-dihydropyran-6-one;ethane.
| Compound Name | (2S)-2-(3,3-dimethylbutyl)-2,3-dihydropyran-6-one;ethane |
|---|---|
| PubChem CID | 142068689 |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.33 g/mol |
| Exact Mass | 212.18 |
| IUPAC Name | (2S)-2-(3,3-dimethylbutyl)-2,3-dihydropyran-6-one;ethane |
| SMILES | CC.CC(C)(C)CC[C@H]1CC=CC(=O)O1 |
| InChI | InChI=1S/C11H18O2.C2H6/c1-11(2,3)8-7-9-5-4-6-10(12)13-9;1-2/h4,6,9H,5,7-8H2,1-3H3;1-2H3/t9-;/m1./s1 |
| InChIKey | QACNXBSIBVXYGM-SBSPUUFOSA-N |
| XLogP | 3.71 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |