C10H15NO3 — CID 176969795
2-(morpholin-4-ylmethyl)-2,3-dihydropyran-6-one (PubChem CID 176969795) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-2,3-dihydropyran-6-one.
| Compound Name | 2-(morpholin-4-ylmethyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 176969795 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(CN2CCOCC2)O1 |
| InChI | InChI=1S/C10H15NO3/c12-10-3-1-2-9(14-10)8-11-4-6-13-7-5-11/h1,3,9H,2,4-8H2 |
| InChIKey | BSYIRTNUCGMNAE-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |