C13H19N3O2 — CID 54487433
2-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-amine (PubChem CID 54487433) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-amine.
| Compound Name | 2-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-amine |
|---|---|
| PubChem CID | 54487433 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-2,3-dihydro-1,4-benzoxazin-4-amine |
| SMILES | NN1CC(CN2CCOCC2)Oc2ccccc21 |
| InChI | InChI=1S/C13H19N3O2/c14-16-10-11(9-15-5-7-17-8-6-15)18-13-4-2-1-3-12(13)16/h1-4,11H,5-10,14H2 |
| InChIKey | XTHRCXLOLPXCGH-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 50.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|