C13H19N3O2 — CID 11994770
2-(morpholin-4-ylmethyl)-3,4-dihydro-2H-1,4-benzoxazin-6-amine (PubChem CID 11994770) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-(morpholin-4-ylmethyl)-3,4-dihydro-2H-1,4-benzoxazin-6-amine.
| Compound Name | 2-(morpholin-4-ylmethyl)-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
|---|---|
| PubChem CID | 11994770 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-(morpholin-4-ylmethyl)-3,4-dihydro-2H-1,4-benzoxazin-6-amine |
| SMILES | Nc1ccc2c(c1)NCC(CN1CCOCC1)O2 |
| InChI | InChI=1S/C13H19N3O2/c14-10-1-2-13-12(7-10)15-8-11(18-13)9-16-3-5-17-6-4-16/h1-2,7,11,15H,3-6,8-9,14H2 |
| InChIKey | XOKAQGSSPNZKLC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 59.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|