C10H9F3N2O2 — CID 125472684
1-[(2R)-6-amino-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-2,2,2-trifluoroethanone (PubChem CID 125472684) has the molecular formula C10H9F3N2O2 and a molecular weight of 246.19 g/mol. Its IUPAC name is 1-[(2R)-6-amino-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(2R)-6-amino-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 125472684 |
| Molecular Formula | C10H9F3N2O2 |
| Molecular Weight | 246.19 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 1-[(2R)-6-amino-3,4-dihydro-2H-1,4-benzoxazin-2-yl]-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc2c(c1)NC[C@H](C(=O)C(F)(F)F)O2 |
| InChI | InChI=1S/C10H9F3N2O2/c11-10(12,13)9(16)8-4-15-6-3-5(14)1-2-7(6)17-8/h1-3,8,15H,4,14H2/t8-/m1/s1 |
| InChIKey | ZNGOUVMNEDDPDM-MRVPVSSYSA-N |
| XLogP | 1.57 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.19 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|