C9H10ClN3O2 — CID 1485704
(2S)-6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carbohydrazide (PubChem CID 1485704) has the molecular formula C9H10ClN3O2 and a molecular weight of 227.65 g/mol. Its IUPAC name is (2S)-6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carbohydrazide.
| Compound Name | (2S)-6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carbohydrazide |
|---|---|
| PubChem CID | 1485704 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | (2S)-6-chloro-3,4-dihydro-2H-1,4-benzoxazine-2-carbohydrazide |
| SMILES | NNC(=O)[C@@H]1CNc2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C9H10ClN3O2/c10-5-1-2-7-6(3-5)12-4-8(15-7)9(14)13-11/h1-3,8,12H,4,11H2,(H,13,14)/t8-/m0/s1 |
| InChIKey | YKOXYTVXRJJPIO-QMMMGPOBSA-N |
| XLogP | 0.50 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|