About methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate
methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate (PubChem CID 59367933) has the molecular formula C11H12ClNO3
and a molecular weight of 241.67 g/mol. Its IUPAC name is methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate.
Analyze methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate?
The IUPAC name of methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate (CID 59367933) is methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate.
What is the SMILES notation for methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate?
The canonical SMILES for methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate is COC(=O)CC1CNc2cc(Cl)ccc2O1.
What is the InChIKey of methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate?
The InChIKey is XTHUQHNEXJOFBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12ClNO3/c1-15-11(14)5-8-6-13-9-4-7(12)2-3-10(9)16-8/h2-4,8,13H,5-6H2,1H3.
What are the key properties of methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate?
methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate has a molecular weight of 241.67 g/mol, XLogP of 2.08, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(6-chloro-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate is sourced from PubChem (CID 59367933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).