C15H12ClIN2O2 — CID 107625509
N-(4-chloro-2-iodophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 107625509) has the molecular formula C15H12ClIN2O2 and a molecular weight of 414.63 g/mol. Its IUPAC name is N-(4-chloro-2-iodophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
| Compound Name | N-(4-chloro-2-iodophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 107625509 |
| Molecular Formula | C15H12ClIN2O2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 413.96 |
| IUPAC Name | N-(4-chloro-2-iodophenyl)-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1I)C1CNc2ccccc2O1 |
| InChI | InChI=1S/C15H12ClIN2O2/c16-9-5-6-11(10(17)7-9)19-15(20)14-8-18-12-3-1-2-4-13(12)21-14/h1-7,14,18H,8H2,(H,19,20) |
| InChIKey | XXBIYRIZRHGHJM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|