C15H14N2O2 — CID 167040387
7-phenyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide (PubChem CID 167040387) has the molecular formula C15H14N2O2 and a molecular weight of 254.29 g/mol. Its IUPAC name is 7-phenyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide.
| Compound Name | 7-phenyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
|---|---|
| PubChem CID | 167040387 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 7-phenyl-3,4-dihydro-2H-1,4-benzoxazine-2-carboxamide |
| SMILES | NC(=O)C1CNc2ccc(-c3ccccc3)cc2O1 |
| InChI | InChI=1S/C15H14N2O2/c16-15(18)14-9-17-12-7-6-11(8-13(12)19-14)10-4-2-1-3-5-10/h1-8,14,17H,9H2,(H2,16,18) |
| InChIKey | PJTDCCBXJSTAPR-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |