C13H21N3O — CID 54431175
2-(diethylaminomethyl)-2,3-dihydro-1,4-benzoxazin-4-amine (PubChem CID 54431175) has the molecular formula C13H21N3O and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(diethylaminomethyl)-2,3-dihydro-1,4-benzoxazin-4-amine.
| Compound Name | 2-(diethylaminomethyl)-2,3-dihydro-1,4-benzoxazin-4-amine |
|---|---|
| PubChem CID | 54431175 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 2-(diethylaminomethyl)-2,3-dihydro-1,4-benzoxazin-4-amine |
| SMILES | CCN(CC)CC1CN(N)c2ccccc2O1 |
| InChI | InChI=1S/C13H21N3O/c1-3-15(4-2)9-11-10-16(14)12-7-5-6-8-13(12)17-11/h5-8,11H,3-4,9-10,14H2,1-2H3 |
| InChIKey | WHOZHQGYDKFRDJ-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|