About (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine
(2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine (PubChem CID 58740927) has the molecular formula C11H15NO2
and a molecular weight of 193.25 g/mol. Its IUPAC name is (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine.
Molecular Properties
| Compound Name | (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine |
| PubChem CID | 58740927 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine |
| SMILES | COC[C@H]1CN(C)c2ccccc2O1 |
| InChI | InChI=1S/C11H15NO2/c1-12-7-9(8-13-2)14-11-6-4-3-5-10(11)12/h3-6,9H,7-8H2,1-2H3/t9-/m1/s1 |
| InChIKey | JWIILAUNGBEUCQ-SECBINFHSA-N |
| XLogP | 1.53 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine?
The IUPAC name of (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine (CID 58740927) is (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine.
What is the SMILES notation for (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine?
The canonical SMILES for (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine is COC[C@H]1CN(C)c2ccccc2O1.
What is the InChIKey of (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine?
The InChIKey is JWIILAUNGBEUCQ-SECBINFHSA-N. The full InChI is InChI=1S/C11H15NO2/c1-12-7-9(8-13-2)14-11-6-4-3-5-10(11)12/h3-6,9H,7-8H2,1-2H3/t9-/m1/s1.
What are the key properties of (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine?
(2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine has a molecular weight of 193.25 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine is sourced from PubChem (CID 58740927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).