About (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane
(2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane (PubChem CID 159298384) has the molecular formula C11H16FNO2S
and a molecular weight of 245.32 g/mol. Its IUPAC name is (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane.
Molecular Properties
| Compound Name | (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane |
| PubChem CID | 159298384 |
| Molecular Formula | C11H16FNO2S |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane |
| SMILES | COC[C@@H]1CN(C)c2cccc(F)c2O1.S |
| InChI | InChI=1S/C11H14FNO2.H2S/c1-13-6-8(7-14-2)15-11-9(12)4-3-5-10(11)13;/h3-5,8H,6-7H2,1-2H3;1H2/t8-;/m0./s1 |
| InChIKey | LBABSIXUYMPLHF-QRPNPIFTSA-N |
| XLogP | 1.78 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane?
The IUPAC name of (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane (CID 159298384) is (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane.
What is the SMILES notation for (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane?
The canonical SMILES for (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane is COC[C@@H]1CN(C)c2cccc(F)c2O1.S.
What is the InChIKey of (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane?
The InChIKey is LBABSIXUYMPLHF-QRPNPIFTSA-N. The full InChI is InChI=1S/C11H14FNO2.H2S/c1-13-6-8(7-14-2)15-11-9(12)4-3-5-10(11)13;/h3-5,8H,6-7H2,1-2H3;1H2/t8-;/m0./s1.
What are the key properties of (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane?
(2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane has a molecular weight of 245.32 g/mol, XLogP of 1.78, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-8-fluoro-2-(methoxymethyl)-4-methyl-2,3-dihydro-1,4-benzoxazine;sulfane is sourced from PubChem (CID 159298384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).