C28H25FN2O5 — CID 66869508
[1-[4-[[(2S)-8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate (PubChem CID 66869508) has the molecular formula C28H25FN2O5 and a molecular weight of 488.52 g/mol. Its IUPAC name is [1-[4-[[(2S)-8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate.
| Compound Name | [1-[4-[[(2S)-8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate |
|---|---|
| PubChem CID | 66869508 |
| Molecular Formula | C28H25FN2O5 |
| Molecular Weight | 488.52 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | [1-[4-[[(2S)-8-fluoro-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate |
| SMILES | CC(=O)Oc1cccc2c1cc(C)n2C(=O)c1ccc(OC[C@@H]2CN(C)c3cccc(F)c3O2)cc1 |
| InChI | InChI=1S/C28H25FN2O5/c1-17-14-22-24(7-5-9-26(22)35-18(2)32)31(17)28(33)19-10-12-20(13-11-19)34-16-21-15-30(3)25-8-4-6-23(29)27(25)36-21/h4-14,21H,15-16H2,1-3H3/t21-/m0/s1 |
| InChIKey | ODTQFHDEQWRVEG-NRFANRHFSA-N |
| XLogP | 4.98 |
| TPSA | 70.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.52 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|