C29H28N2O6 — CID 66869859
[1-[4-[[(2S)-6-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate (PubChem CID 66869859) has the molecular formula C29H28N2O6 and a molecular weight of 500.55 g/mol. Its IUPAC name is [1-[4-[[(2S)-6-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate.
| Compound Name | [1-[4-[[(2S)-6-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate |
|---|---|
| PubChem CID | 66869859 |
| Molecular Formula | C29H28N2O6 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.19 |
| IUPAC Name | [1-[4-[[(2S)-6-methoxy-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl]-2-methylindol-4-yl] acetate |
| SMILES | COc1ccc2c(c1)N(C)C[C@@H](COc1ccc(C(=O)n3c(C)cc4c(OC(C)=O)cccc43)cc1)O2 |
| InChI | InChI=1S/C29H28N2O6/c1-18-14-24-25(6-5-7-27(24)36-19(2)32)31(18)29(33)20-8-10-21(11-9-20)35-17-23-16-30(3)26-15-22(34-4)12-13-28(26)37-23/h5-15,23H,16-17H2,1-4H3/t23-/m0/s1 |
| InChIKey | HBUNUFJUUQSJRI-QHCPKHFHSA-N |
| XLogP | 4.85 |
| TPSA | 79.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|