C19H20ClNO3 — CID 86609831
2,5-dimethyl-4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl chloride (PubChem CID 86609831) has the molecular formula C19H20ClNO3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 2,5-dimethyl-4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl chloride.
| Compound Name | 2,5-dimethyl-4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl chloride |
|---|---|
| PubChem CID | 86609831 |
| Molecular Formula | C19H20ClNO3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 2,5-dimethyl-4-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]benzoyl chloride |
| SMILES | Cc1cc(C(=O)Cl)c(C)cc1OC[C@@H]1CN(C)c2ccccc2O1 |
| InChI | InChI=1S/C19H20ClNO3/c1-12-9-18(13(2)8-15(12)19(20)22)23-11-14-10-21(3)16-6-4-5-7-17(16)24-14/h4-9,14H,10-11H2,1-3H3/t14-/m0/s1 |
| InChIKey | SPIIWIXAOJWCHP-AWEZNQCLSA-N |
| XLogP | 3.96 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|