C16H18N2O4 — CID 163481006
[6-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]-3-pyridinyl]methanediol (PubChem CID 163481006) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is [6-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]-3-pyridinyl]methanediol.
| Compound Name | [6-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]-3-pyridinyl]methanediol |
|---|---|
| PubChem CID | 163481006 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | [6-[[(2S)-4-methyl-2,3-dihydro-1,4-benzoxazin-2-yl]methoxy]-3-pyridinyl]methanediol |
| SMILES | CN1C[C@@H](COc2ccc(C(O)O)cn2)Oc2ccccc21 |
| InChI | InChI=1S/C16H18N2O4/c1-18-9-12(22-14-5-3-2-4-13(14)18)10-21-15-7-6-11(8-17-15)16(19)20/h2-8,12,16,19-20H,9-10H2,1H3/t12-/m0/s1 |
| InChIKey | CENDLTDKNJJSHG-LBPRGKRZSA-N |
| XLogP | 1.34 |
| TPSA | 75.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|