C14H21ClN4O — CID 54342977
8-chloro-2-[(4-methylpiperazin-1-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-amine (PubChem CID 54342977) has the molecular formula C14H21ClN4O and a molecular weight of 296.80 g/mol. Its IUPAC name is 8-chloro-2-[(4-methylpiperazin-1-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-amine.
| Compound Name | 8-chloro-2-[(4-methylpiperazin-1-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-amine |
|---|---|
| PubChem CID | 54342977 |
| Molecular Formula | C14H21ClN4O |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | 8-chloro-2-[(4-methylpiperazin-1-yl)methyl]-2,3-dihydro-1,4-benzoxazin-4-amine |
| SMILES | CN1CCN(CC2CN(N)c3cccc(Cl)c3O2)CC1 |
| InChI | InChI=1S/C14H21ClN4O/c1-17-5-7-18(8-6-17)9-11-10-19(16)13-4-2-3-12(15)14(13)20-11/h2-4,11H,5-10,16H2,1H3 |
| InChIKey | UAGXPPFZAIOWRY-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 44.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|