C15H28Cl2N2O3 — CID 53422915
2,5-bis(morpholin-4-ylmethyl)cyclopentan-1-one;dihydrochloride (PubChem CID 53422915) has the molecular formula C15H28Cl2N2O3 and a molecular weight of 355.31 g/mol. Its IUPAC name is 2,5-bis(morpholin-4-ylmethyl)cyclopentan-1-one;dihydrochloride.
| Compound Name | 2,5-bis(morpholin-4-ylmethyl)cyclopentan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 53422915 |
| Molecular Formula | C15H28Cl2N2O3 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 2,5-bis(morpholin-4-ylmethyl)cyclopentan-1-one;dihydrochloride |
| SMILES | Cl.Cl.O=C1C(CN2CCOCC2)CCC1CN1CCOCC1 |
| InChI | InChI=1S/C15H26N2O3.2ClH/c18-15-13(11-16-3-7-19-8-4-16)1-2-14(15)12-17-5-9-20-10-6-17;;/h13-14H,1-12H2;2*1H |
| InChIKey | HFGDGCHOFFECOG-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |