C14H16O3 — CID 162666054
(2R)-2-[(4-ethylphenoxy)methyl]-2,3-dihydropyran-6-one (PubChem CID 162666054) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2R)-2-[(4-ethylphenoxy)methyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(4-ethylphenoxy)methyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 162666054 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2R)-2-[(4-ethylphenoxy)methyl]-2,3-dihydropyran-6-one |
| SMILES | CCc1ccc(OC[C@H]2CC=CC(=O)O2)cc1 |
| InChI | InChI=1S/C14H16O3/c1-2-11-6-8-12(9-7-11)16-10-13-4-3-5-14(15)17-13/h3,5-9,13H,2,4,10H2,1H3/t13-/m1/s1 |
| InChIKey | YKOOKTMVGRGAGB-CYBMUJFWSA-N |
| XLogP | 2.50 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |