C18H16O3 — CID 56668686
2-(4-phenylmethoxyphenyl)-2,3-dihydropyran-6-one (PubChem CID 56668686) has the molecular formula C18H16O3 and a molecular weight of 280.32 g/mol. Its IUPAC name is 2-(4-phenylmethoxyphenyl)-2,3-dihydropyran-6-one.
| Compound Name | 2-(4-phenylmethoxyphenyl)-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 56668686 |
| Molecular Formula | C18H16O3 |
| Molecular Weight | 280.32 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 2-(4-phenylmethoxyphenyl)-2,3-dihydropyran-6-one |
| SMILES | O=C1C=CCC(c2ccc(OCc3ccccc3)cc2)O1 |
| InChI | InChI=1S/C18H16O3/c19-18-8-4-7-17(21-18)15-9-11-16(12-10-15)20-13-14-5-2-1-3-6-14/h1-6,8-12,17H,7,13H2 |
| InChIKey | CFFZNIVAIKKDFT-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.32 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |