C16H15BrO — CID 130539986
1-[(1S,2R)-2-bromocyclopropyl]-4-phenylmethoxybenzene (PubChem CID 130539986) has the molecular formula C16H15BrO and a molecular weight of 303.20 g/mol. Its IUPAC name is 1-[(1S,2R)-2-bromocyclopropyl]-4-phenylmethoxybenzene.
| Compound Name | 1-[(1S,2R)-2-bromocyclopropyl]-4-phenylmethoxybenzene |
|---|---|
| PubChem CID | 130539986 |
| Molecular Formula | C16H15BrO |
| Molecular Weight | 303.20 g/mol |
| Exact Mass | 302.03 |
| IUPAC Name | 1-[(1S,2R)-2-bromocyclopropyl]-4-phenylmethoxybenzene |
| SMILES | Br[C@@H]1C[C@H]1c1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C16H15BrO/c17-16-10-15(16)13-6-8-14(9-7-13)18-11-12-4-2-1-3-5-12/h1-9,15-16H,10-11H2/t15-,16+/m0/s1 |
| InChIKey | UMLXKRDQGQFRFY-JKSUJKDBSA-N |
| XLogP | 4.52 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.20 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|