About (4-phenylmethoxyphenyl) hypobromite
(4-phenylmethoxyphenyl) hypobromite (PubChem CID 151898979) has the molecular formula C13H11BrO2
and a molecular weight of 279.13 g/mol. Its IUPAC name is (4-phenylmethoxyphenyl) hypobromite.
Molecular Properties
| Compound Name | (4-phenylmethoxyphenyl) hypobromite |
| PubChem CID | 151898979 |
| Molecular Formula | C13H11BrO2 |
| Molecular Weight | 279.13 g/mol |
| Exact Mass | 277.99 |
| IUPAC Name | (4-phenylmethoxyphenyl) hypobromite |
| SMILES | BrOc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C13H11BrO2/c14-16-13-8-6-12(7-9-13)15-10-11-4-2-1-3-5-11/h1-9H,10H2 |
| InChIKey | SSIYJOAPUWKYHB-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.13 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4-phenylmethoxyphenyl) hypobromite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-phenylmethoxyphenyl) hypobromite?
The IUPAC name of (4-phenylmethoxyphenyl) hypobromite (CID 151898979) is (4-phenylmethoxyphenyl) hypobromite.
What is the SMILES notation for (4-phenylmethoxyphenyl) hypobromite?
The canonical SMILES for (4-phenylmethoxyphenyl) hypobromite is BrOc1ccc(OCc2ccccc2)cc1.
What is the InChIKey of (4-phenylmethoxyphenyl) hypobromite?
The InChIKey is SSIYJOAPUWKYHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO2/c14-16-13-8-6-12(7-9-13)15-10-11-4-2-1-3-5-11/h1-9H,10H2.
What are the key properties of (4-phenylmethoxyphenyl) hypobromite?
(4-phenylmethoxyphenyl) hypobromite has a molecular weight of 279.13 g/mol, XLogP of 3.95, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-phenylmethoxyphenyl) hypobromite is sourced from PubChem (CID 151898979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).