About 1-bromo-4-phenylmethoxybenzene;oxolane
1-bromo-4-phenylmethoxybenzene;oxolane (PubChem CID 175495084) has the molecular formula C17H19BrO2
and a molecular weight of 335.24 g/mol. Its IUPAC name is 1-bromo-4-phenylmethoxybenzene;oxolane.
Molecular Properties
| Compound Name | 1-bromo-4-phenylmethoxybenzene;oxolane |
| PubChem CID | 175495084 |
| Molecular Formula | C17H19BrO2 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | 1-bromo-4-phenylmethoxybenzene;oxolane |
| SMILES | Brc1ccc(OCc2ccccc2)cc1.C1CCOC1 |
| InChI | InChI=1S/C13H11BrO.C4H8O/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;1-2-4-5-3-1/h1-9H,10H2;1-4H2 |
| InChIKey | NAEUNGRVVOYFCN-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-bromo-4-phenylmethoxybenzene;oxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-4-phenylmethoxybenzene;oxolane?
The IUPAC name of 1-bromo-4-phenylmethoxybenzene;oxolane (CID 175495084) is 1-bromo-4-phenylmethoxybenzene;oxolane.
What is the SMILES notation for 1-bromo-4-phenylmethoxybenzene;oxolane?
The canonical SMILES for 1-bromo-4-phenylmethoxybenzene;oxolane is Brc1ccc(OCc2ccccc2)cc1.C1CCOC1.
What is the InChIKey of 1-bromo-4-phenylmethoxybenzene;oxolane?
The InChIKey is NAEUNGRVVOYFCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrO.C4H8O/c14-12-6-8-13(9-7-12)15-10-11-4-2-1-3-5-11;1-2-4-5-3-1/h1-9H,10H2;1-4H2.
What are the key properties of 1-bromo-4-phenylmethoxybenzene;oxolane?
1-bromo-4-phenylmethoxybenzene;oxolane has a molecular weight of 335.24 g/mol, XLogP of 4.82, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-4-phenylmethoxybenzene;oxolane is sourced from PubChem (CID 175495084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).