C19H21NO3 — CID 67354065
(6R)-4-ethyl-6-(4-phenylmethoxyphenyl)morpholin-3-one (PubChem CID 67354065) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is (6R)-4-ethyl-6-(4-phenylmethoxyphenyl)morpholin-3-one.
| Compound Name | (6R)-4-ethyl-6-(4-phenylmethoxyphenyl)morpholin-3-one |
|---|---|
| PubChem CID | 67354065 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (6R)-4-ethyl-6-(4-phenylmethoxyphenyl)morpholin-3-one |
| SMILES | CCN1C[C@@H](c2ccc(OCc3ccccc3)cc2)OCC1=O |
| InChI | InChI=1S/C19H21NO3/c1-2-20-12-18(23-14-19(20)21)16-8-10-17(11-9-16)22-13-15-6-4-3-5-7-15/h3-11,18H,2,12-14H2,1H3/t18-/m0/s1 |
| InChIKey | XGWSOKNCEJDPBD-SFHVURJKSA-N |
| XLogP | 3.19 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |